kajasmIsabelds kajasmIsabelds

24-10-2016
Biology

contestada

what does density limiting factors include

Respuesta :

gardeaj gardeaj

02-11-2016

Examples; food availability, predation, disease and migration.
Density limiting factors is anything that affects the growth of a population.

Answer Link

Otras preguntas

Nicolas Enterprises sells a product for $67 per unit. The variable cost is $33 per unit, while fixed costs are $231,200. Determine (a) the break-even point in s

PLS PLS HELP---- In the Prologue of Romeo and Juliet, the Chorus calls Romeo and Juliet “star-crossed lovers.” In at least 200 words, explain how this idea of b

Suppose you have $1,000,000 today and starting a year from now you intend to spend this money over the next 30 years. Assume the nominal rate of interest is 9.2

Give the IUPAC name of the given compound.(CH3)-CH(NH2)-CH3

Two unknown resistors are connected together. When they are connected in series their equivalent resistance is 15 Ω. When they are connected in parallel, their

Identify the complete adverb clause. What does the adverb clause answer? Let's write our compositions now so that we can go to the basketball game. A. Let's w

Two unknown resistors are connected together. When they are connected in series their equivalent resistance is 15 Ω. When they are connected in parallel, their

Match the qualifications that determine how the leader is chosen for each group listed: 1. Family Authority or Status 2. Club Ability to Influence 3. Athletic t

Is the connotation of “loot” positive, negative, or neutral?

An HR manager would like to test the hypothesis that the proportion of agenda-less meetings is more than 45%. Based on the information below, choose the correct